C21H22FN3O3S — CID 1366445
3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 1366445) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 1366445 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | CCNC(=S)N(Cc1ccc(OC)cc1)[C@@H]1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H22FN3O3S/c1-3-23-21(29)24(13-14-4-10-17(28-2)11-5-14)18-12-19(26)25(20(18)27)16-8-6-15(22)7-9-16/h4-11,18H,3,12-13H2,1-2H3,(H,23,29)/t18-/m1/s1 |
| InChIKey | AVWGGFRYGBQBJS-GOSISDBHSA-N |
| XLogP | 2.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|