C27H23FN2O6 — CID 23803473
[4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23803473) has the molecular formula C27H23FN2O6 and a molecular weight of 490.49 g/mol. Its IUPAC name is [4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23803473 |
| Molecular Formula | C27H23FN2O6 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | COc1ccc(C(=O)N(Cc2ccc(F)cc2)C2CC(=O)N(c3ccc(OC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H23FN2O6/c1-17(31)36-23-13-9-21(10-14-23)30-25(32)15-24(27(30)34)29(16-18-3-7-20(28)8-4-18)26(33)19-5-11-22(35-2)12-6-19/h3-14,24H,15-16H2,1-2H3 |
| InChIKey | OZPZVZWIVNWVSO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|