C28H25FN2O6 — CID 23916464
ethyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23916464) has the molecular formula C28H25FN2O6 and a molecular weight of 504.51 g/mol. Its IUPAC name is ethyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23916464 |
| Molecular Formula | C28H25FN2O6 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | ethyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc(F)cc3)C(=O)c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H25FN2O6/c1-3-37-28(35)20-6-12-22(13-7-20)31-25(32)16-24(27(31)34)30(17-18-4-10-21(29)11-5-18)26(33)19-8-14-23(36-2)15-9-19/h4-15,24H,3,16-17H2,1-2H3 |
| InChIKey | PDQFQDBCGDJBHQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|