C26H20FN3O7 — CID 23916563
methyl 4-[3-[(4-fluorophenyl)methyl-(4-nitrobenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23916563) has the molecular formula C26H20FN3O7 and a molecular weight of 505.46 g/mol. Its IUPAC name is methyl 4-[3-[(4-fluorophenyl)methyl-(4-nitrobenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[(4-fluorophenyl)methyl-(4-nitrobenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23916563 |
| Molecular Formula | C26H20FN3O7 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | methyl 4-[3-[(4-fluorophenyl)methyl-(4-nitrobenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc(F)cc3)C(=O)c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H20FN3O7/c1-37-26(34)18-6-10-20(11-7-18)29-23(31)14-22(25(29)33)28(15-16-2-8-19(27)9-3-16)24(32)17-4-12-21(13-5-17)30(35)36/h2-13,22H,14-15H2,1H3 |
| InChIKey | WWTXZBLZVKZSLW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|