C27H22ClN3O7 — CID 23888391
methyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23888391) has the molecular formula C27H22ClN3O7 and a molecular weight of 535.94 g/mol. Its IUPAC name is methyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23888391 |
| Molecular Formula | C27H22ClN3O7 |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | methyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc(C)cc3)C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C27H22ClN3O7/c1-16-3-5-17(6-4-16)15-29(25(33)19-9-12-21(28)22(13-19)31(36)37)23-14-24(32)30(26(23)34)20-10-7-18(8-11-20)27(35)38-2/h3-13,23H,14-15H2,1-2H3 |
| InChIKey | WHELRRLCNJPBCF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|