C28H23Cl2N3O7 — CID 23774325
ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[2-(3-chlorophenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23774325) has the molecular formula C28H23Cl2N3O7 and a molecular weight of 584.41 g/mol. Its IUPAC name is ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[2-(3-chlorophenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[2-(3-chlorophenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23774325 |
| Molecular Formula | C28H23Cl2N3O7 |
| Molecular Weight | 584.41 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-[2-(3-chlorophenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(CCc3cccc(Cl)c3)C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C28H23Cl2N3O7/c1-2-40-28(37)18-6-9-21(10-7-18)32-25(34)16-24(27(32)36)31(13-12-17-4-3-5-20(29)14-17)26(35)19-8-11-22(30)23(15-19)33(38)39/h3-11,14-15,24H,2,12-13,16H2,1H3 |
| InChIKey | PTVXJNQSFJTOJU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|