C31H33ClN2O6S — CID 23914848
ethyl 4-[3-[2-(3-chlorophenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23914848) has the molecular formula C31H33ClN2O6S and a molecular weight of 597.13 g/mol. Its IUPAC name is ethyl 4-[3-[2-(3-chlorophenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[2-(3-chlorophenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23914848 |
| Molecular Formula | C31H33ClN2O6S |
| Molecular Weight | 597.13 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | ethyl 4-[3-[2-(3-chlorophenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(CCc3cccc(Cl)c3)S(=O)(=O)c3c(C)c(C)cc(C)c3C)C2=O)cc1 |
| InChI | InChI=1S/C31H33ClN2O6S/c1-6-40-31(37)24-10-12-26(13-11-24)34-28(35)18-27(30(34)36)33(15-14-23-8-7-9-25(32)17-23)41(38,39)29-21(4)19(2)16-20(3)22(29)5/h7-13,16-17,27H,6,14-15,18H2,1-5H3 |
| InChIKey | CXPAUUBLAAABRA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.13 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|