C26H22Cl2N2O3 — CID 23803625
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-4-methylbenzamide (PubChem CID 23803625) has the molecular formula C26H22Cl2N2O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-4-methylbenzamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 23803625 |
| Molecular Formula | C26H22Cl2N2O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCc2cccc(Cl)c2)C2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O3/c1-17-5-7-19(8-6-17)25(32)29(14-13-18-3-2-4-21(28)15-18)23-16-24(31)30(26(23)33)22-11-9-20(27)10-12-22/h2-12,15,23H,13-14,16H2,1H3 |
| InChIKey | NWOYEBMQHUZWJR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|