C28H26ClN3O4 — CID 23803578
N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-2-methylbenzamide (PubChem CID 23803578) has the molecular formula C28H26ClN3O4 and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-2-methylbenzamide.
| Compound Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 23803578 |
| Molecular Formula | C28H26ClN3O4 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3-chlorophenyl)ethyl]-2-methylbenzamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(CCc3cccc(Cl)c3)C(=O)c3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C28H26ClN3O4/c1-18-6-3-4-9-24(18)27(35)31(15-14-20-7-5-8-21(29)16-20)25-17-26(34)32(28(25)36)23-12-10-22(11-13-23)30-19(2)33/h3-13,16,25H,14-15,17H2,1-2H3,(H,30,33) |
| InChIKey | MDJUXBIVIJTIPC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|