C25H27N3O5 — CID 23916588
N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methyl-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 23916588) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methyl-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methyl-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 23916588 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methyl-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(CC3CCCO3)C(=O)c3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C25H27N3O5/c1-16-6-3-4-8-21(16)24(31)27(15-20-7-5-13-33-20)22-14-23(30)28(25(22)32)19-11-9-18(10-12-19)26-17(2)29/h3-4,6,8-12,20,22H,5,7,13-15H2,1-2H3,(H,26,29) |
| InChIKey | KTIJFYMERSFRLL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|