C25H26N2O6 — CID 23971005
[4-[2,5-dioxo-3-[oxolan-2-ylmethyl-(2-phenylacetyl)amino]pyrrolidin-1-yl]phenyl] acetate (PubChem CID 23971005) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is [4-[2,5-dioxo-3-[oxolan-2-ylmethyl-(2-phenylacetyl)amino]pyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[2,5-dioxo-3-[oxolan-2-ylmethyl-(2-phenylacetyl)amino]pyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23971005 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [4-[2,5-dioxo-3-[oxolan-2-ylmethyl-(2-phenylacetyl)amino]pyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)CC(N(CC3CCCO3)C(=O)Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H26N2O6/c1-17(28)33-20-11-9-19(10-12-20)27-24(30)15-22(25(27)31)26(16-21-8-5-13-32-21)23(29)14-18-6-3-2-4-7-18/h2-4,6-7,9-12,21-22H,5,8,13-16H2,1H3 |
| InChIKey | KTSCHQQFOMOELQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|