C23H23ClN2O5 — CID 23860686
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 23860686) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 23860686 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(CC2CCCO2)C2CC(=O)N(c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C23H23ClN2O5/c1-30-18-5-2-4-15(12-18)22(28)25(14-19-6-3-11-31-19)20-13-21(27)26(23(20)29)17-9-7-16(24)8-10-17/h2,4-5,7-10,12,19-20H,3,6,11,13-14H2,1H3 |
| InChIKey | HIXUSRQIHSKIEM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|