C29H30N2O4 — CID 23860685
N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide (PubChem CID 23860685) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide.
| Compound Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 23860685 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(CCc2ccccc2)C2CC(=O)N(c3ccc(C(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C29H30N2O4/c1-20(2)22-12-14-24(15-13-22)31-27(32)19-26(29(31)34)30(17-16-21-8-5-4-6-9-21)28(33)23-10-7-11-25(18-23)35-3/h4-15,18,20,26H,16-17,19H2,1-3H3 |
| InChIKey | NYUVUNWPNMMUHR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|