C27H23N3O4 — CID 23832245
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide (PubChem CID 23832245) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 23832245 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(2-phenylethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(CCc2ccccc2)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)c1 |
| InChI | InChI=1S/C27H23N3O4/c1-34-23-9-5-8-21(16-23)26(32)29(15-14-19-6-3-2-4-7-19)24-17-25(31)30(27(24)33)22-12-10-20(18-28)11-13-22/h2-13,16,24H,14-15,17H2,1H3 |
| InChIKey | FYUQWGGGQOQASE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|