C26H27N3O4 — CID 23888438
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3-methoxybenzamide (PubChem CID 23888438) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3-methoxybenzamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3-methoxybenzamide |
|---|---|
| PubChem CID | 23888438 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(C2CCCCCC2)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-33-22-10-6-7-19(15-22)25(31)28(20-8-4-2-3-5-9-20)23-16-24(30)29(26(23)32)21-13-11-18(17-27)12-14-21/h6-7,10-15,20,23H,2-5,8-9,16H2,1H3 |
| InChIKey | HEEWJFRSKMWZAT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|