C26H23IN2O4 — CID 23888447
N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(1-phenylethyl)benzamide (PubChem CID 23888447) has the molecular formula C26H23IN2O4 and a molecular weight of 554.38 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(1-phenylethyl)benzamide.
| Compound Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 23888447 |
| Molecular Formula | C26H23IN2O4 |
| Molecular Weight | 554.38 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxy-N-(1-phenylethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(C2CC(=O)N(c3ccc(I)cc3)C2=O)C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H23IN2O4/c1-17(18-7-4-3-5-8-18)28(25(31)19-9-6-10-22(15-19)33-2)23-16-24(30)29(26(23)32)21-13-11-20(27)12-14-21/h3-15,17,23H,16H2,1-2H3 |
| InChIKey | UDJHYIOIRYEVCO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|