C22H23FN2O4 — CID 23745207
N-butan-2-yl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxybenzamide (PubChem CID 23745207) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-butan-2-yl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxybenzamide.
| Compound Name | N-butan-2-yl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 23745207 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-butan-2-yl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methoxybenzamide |
| SMILES | CCC(C)N(C(=O)c1cccc(OC)c1)C1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C22H23FN2O4/c1-4-14(2)24(21(27)15-6-5-7-18(12-15)29-3)19-13-20(26)25(22(19)28)17-10-8-16(23)9-11-17/h5-12,14,19H,4,13H2,1-3H3 |
| InChIKey | ZUUNAQCJKGAMJE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|