C22H25N3O5S — CID 25038531
N-butan-2-yl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-methylbenzamide (PubChem CID 25038531) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-butan-2-yl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-methylbenzamide.
| Compound Name | N-butan-2-yl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 25038531 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-butan-2-yl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-methylbenzamide |
| SMILES | CCC(C)N(C(=O)c1cccc(C)c1)C1CC(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C22H25N3O5S/c1-4-15(3)24(21(27)16-7-5-6-14(2)12-16)19-13-20(26)25(22(19)28)17-8-10-18(11-9-17)31(23,29)30/h5-12,15,19H,4,13H2,1-3H3,(H2,23,29,30) |
| InChIKey | WGABVLDRYLJHEO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|