C21H21ClN4O7S — CID 25049612
N-butan-2-yl-4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide (PubChem CID 25049612) has the molecular formula C21H21ClN4O7S and a molecular weight of 508.94 g/mol. Its IUPAC name is N-butan-2-yl-4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide.
| Compound Name | N-butan-2-yl-4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 25049612 |
| Molecular Formula | C21H21ClN4O7S |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | N-butan-2-yl-4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide |
| SMILES | CCC(C)N(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C1CC(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C21H21ClN4O7S/c1-3-12(2)24(20(28)13-4-9-16(22)17(10-13)26(30)31)18-11-19(27)25(21(18)29)14-5-7-15(8-6-14)34(23,32)33/h4-10,12,18H,3,11H2,1-2H3,(H2,23,32,33) |
| InChIKey | NADVHWOEHHDUGQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 160.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|