C22H21Cl2N3O5 — CID 23916406
4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-3-nitrobenzamide (PubChem CID 23916406) has the molecular formula C22H21Cl2N3O5 and a molecular weight of 478.33 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 23916406 |
| Molecular Formula | C22H21Cl2N3O5 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 4-chloro-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-3-nitrobenzamide |
| SMILES | CCC(C)(C)N(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H21Cl2N3O5/c1-4-22(2,3)26(20(29)13-5-10-16(24)17(11-13)27(31)32)18-12-19(28)25(21(18)30)15-8-6-14(23)7-9-15/h5-11,18H,4,12H2,1-3H3 |
| InChIKey | OPFYSMBQECOSSX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|