C24H28N2O5 — CID 23916425
N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,4-dimethoxy-N-(2-methylbutan-2-yl)benzamide (PubChem CID 23916425) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,4-dimethoxy-N-(2-methylbutan-2-yl)benzamide.
| Compound Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,4-dimethoxy-N-(2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 23916425 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,4-dimethoxy-N-(2-methylbutan-2-yl)benzamide |
| SMILES | CCC(C)(C)N(C(=O)c1ccc(OC)c(OC)c1)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H28N2O5/c1-6-24(2,3)26(22(28)16-12-13-19(30-4)20(14-16)31-5)18-15-21(27)25(23(18)29)17-10-8-7-9-11-17/h7-14,18H,6,15H2,1-5H3 |
| InChIKey | BGYNMAPJPAGXNF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|