C23H25FN2O3 — CID 23972507
2-fluoro-N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23972507) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is 2-fluoro-N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | 2-fluoro-N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23972507 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-fluoro-N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | CCC(C)(C)N(C(=O)c1ccccc1F)C1CC(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C23H25FN2O3/c1-5-23(3,4)26(21(28)17-8-6-7-9-18(17)24)19-14-20(27)25(22(19)29)16-12-10-15(2)11-13-16/h6-13,19H,5,14H2,1-4H3 |
| InChIKey | AOEDVANZESJSHP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|