C24H20FN3O3 — CID 23972511
2-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 23972511) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 23972511 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-fluoro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(Cc3cccnc3)C(=O)c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C24H20FN3O3/c1-16-8-10-18(11-9-16)28-22(29)13-21(24(28)31)27(15-17-5-4-12-26-14-17)23(30)19-6-2-3-7-20(19)25/h2-12,14,21H,13,15H2,1H3 |
| InChIKey | QDOKSHDHYHXVIN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|