C24H19F2N3O5S — CID 25043380
N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-fluoro-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 25043380) has the molecular formula C24H19F2N3O5S and a molecular weight of 499.50 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-fluoro-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-fluoro-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 25043380 |
| Molecular Formula | C24H19F2N3O5S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-2-fluoro-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3ccc(F)cc3)C(=O)c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C24H19F2N3O5S/c25-16-7-5-15(6-8-16)14-28(23(31)19-3-1-2-4-20(19)26)21-13-22(30)29(24(21)32)17-9-11-18(12-10-17)35(27,33)34/h1-12,21H,13-14H2,(H2,27,33,34) |
| InChIKey | RPJVPYBJNILDGI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|