C26H24FN3O5S — CID 25037176
N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 25037176) has the molecular formula C26H24FN3O5S and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 25037176 |
| Molecular Formula | C26H24FN3O5S |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)N(CCc2ccc(S(N)(=O)=O)cc2)C2CC(=O)N(c3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H24FN3O5S/c1-17-3-2-4-19(15-17)25(32)29(14-13-18-5-11-22(12-6-18)36(28,34)35)23-16-24(31)30(26(23)33)21-9-7-20(27)8-10-21/h2-12,15,23H,13-14,16H2,1H3,(H2,28,34,35) |
| InChIKey | VHCLFCVKIVKPMN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|