C26H24ClN3O5S — CID 25046468
N-[2-(3-chlorophenyl)ethyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-methylbenzamide (PubChem CID 25046468) has the molecular formula C26H24ClN3O5S and a molecular weight of 526.01 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-methylbenzamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 25046468 |
| Molecular Formula | C26H24ClN3O5S |
| Molecular Weight | 526.01 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCc2cccc(Cl)c2)C2CC(=O)N(c3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24ClN3O5S/c1-17-5-7-19(8-6-17)25(32)29(14-13-18-3-2-4-20(27)15-18)23-16-24(31)30(26(23)33)21-9-11-22(12-10-21)36(28,34)35/h2-12,15,23H,13-14,16H2,1H3,(H2,28,34,35) |
| InChIKey | FTADUPNBMVMZSG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.01 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|