C26H24BrN3O6S — CID 25038512
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 25038512) has the molecular formula C26H24BrN3O6S and a molecular weight of 586.46 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 25038512 |
| Molecular Formula | C26H24BrN3O6S |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 585.06 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N(CCc2ccc(S(N)(=O)=O)cc2)C2CC(=O)N(c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24BrN3O6S/c1-36-21-10-4-18(5-11-21)25(32)29(15-14-17-2-12-22(13-3-17)37(28,34)35)23-16-24(31)30(26(23)33)20-8-6-19(27)7-9-20/h2-13,23H,14-16H2,1H3,(H2,28,34,35) |
| InChIKey | UGAMMNMOZXSHPX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|