C25H25N3O7S — CID 25043221
N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide (PubChem CID 25043221) has the molecular formula C25H25N3O7S and a molecular weight of 511.56 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide.
| Compound Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25043221 |
| Molecular Formula | C25H25N3O7S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)C(=O)c3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O7S/c1-2-34-19-9-7-18(8-10-19)28-23(29)16-21(24(28)30)27(25(31)22-4-3-15-35-22)14-13-17-5-11-20(12-6-17)36(26,32)33/h3-12,15,21H,2,13-14,16H2,1H3,(H2,26,32,33) |
| InChIKey | WAJRCSPGCDFVCL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|