C23H19IN2O4 — CID 23915227
N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)furan-2-carboxamide (PubChem CID 23915227) has the molecular formula C23H19IN2O4 and a molecular weight of 514.32 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)furan-2-carboxamide.
| Compound Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 23915227 |
| Molecular Formula | C23H19IN2O4 |
| Molecular Weight | 514.32 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)furan-2-carboxamide |
| SMILES | O=C1CC(N(CCc2ccccc2)C(=O)c2ccco2)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C23H19IN2O4/c24-17-8-10-18(11-9-17)26-21(27)15-19(22(26)28)25(23(29)20-7-4-14-30-20)13-12-16-5-2-1-3-6-16/h1-11,14,19H,12-13,15H2 |
| InChIKey | IESOHMFLVMKVMF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|