C24H21ClN2O5 — CID 23859354
N-[(2-chlorophenyl)methyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide (PubChem CID 23859354) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 23859354 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(Cc3ccccc3Cl)C(=O)c3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C24H21ClN2O5/c1-2-31-18-11-9-17(10-12-18)27-22(28)14-20(23(27)29)26(24(30)21-8-5-13-32-21)15-16-6-3-4-7-19(16)25/h3-13,20H,2,14-15H2,1H3 |
| InChIKey | TXJVBKCVUONXSF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|