C28H25ClN2O7 — CID 23832212
[4-[3-[(2-chlorophenyl)methyl-(3,4-dimethoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23832212) has the molecular formula C28H25ClN2O7 and a molecular weight of 536.97 g/mol. Its IUPAC name is [4-[3-[(2-chlorophenyl)methyl-(3,4-dimethoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[(2-chlorophenyl)methyl-(3,4-dimethoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23832212 |
| Molecular Formula | C28H25ClN2O7 |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | [4-[3-[(2-chlorophenyl)methyl-(3,4-dimethoxybenzoyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | COc1ccc(C(=O)N(Cc2ccccc2Cl)C2CC(=O)N(c3ccc(OC(C)=O)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C28H25ClN2O7/c1-17(32)38-21-11-9-20(10-12-21)31-26(33)15-23(28(31)35)30(16-19-6-4-5-7-22(19)29)27(34)18-8-13-24(36-2)25(14-18)37-3/h4-14,23H,15-16H2,1-3H3 |
| InChIKey | SCHSBFBDNGKFCA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|