C26H23IN2O5 — CID 23972425
N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide (PubChem CID 23972425) has the molecular formula C26H23IN2O5 and a molecular weight of 570.38 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23972425 |
| Molecular Formula | C26H23IN2O5 |
| Molecular Weight | 570.38 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N(Cc2ccccc2)C2CC(=O)N(c3ccc(I)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H23IN2O5/c1-33-22-13-8-18(14-23(22)34-2)25(31)28(16-17-6-4-3-5-7-17)21-15-24(30)29(26(21)32)20-11-9-19(27)10-12-20/h3-14,21H,15-16H2,1-2H3 |
| InChIKey | UIVQRNZPOSFEOP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|