C23H25FN2O7 — CID 23860670
N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide (PubChem CID 23860670) has the molecular formula C23H25FN2O7 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23860670 |
| Molecular Formula | C23H25FN2O7 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CC(OC)OC)C2CC(=O)N(c3ccc(F)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C23H25FN2O7/c1-30-18-10-5-14(11-19(18)31-2)22(28)25(13-21(32-3)33-4)17-12-20(27)26(23(17)29)16-8-6-15(24)7-9-16/h5-11,17,21H,12-13H2,1-4H3 |
| InChIKey | CXSDCXGKIFTOGT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|