C22H23IN2O6 — CID 23803485
N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzamide (PubChem CID 23803485) has the molecular formula C22H23IN2O6 and a molecular weight of 538.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23803485 |
| Molecular Formula | C22H23IN2O6 |
| Molecular Weight | 538.34 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CC(OC)OC)C2CC(=O)N(c3ccc(I)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H23IN2O6/c1-29-17-10-4-14(5-11-17)21(27)24(13-20(30-2)31-3)18-12-19(26)25(22(18)28)16-8-6-15(23)7-9-16/h4-11,18,20H,12-13H2,1-3H3 |
| InChIKey | FKARNGMIDCZVBA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|