C29H27N3O7 — CID 23972466
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-3-methoxybenzamide (PubChem CID 23972466) has the molecular formula C29H27N3O7 and a molecular weight of 529.55 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-3-methoxybenzamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 23972466 |
| Molecular Formula | C29H27N3O7 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(CC(OC)OC)C2CC(=O)N(c3ccc(-c4nc5ccccc5o4)cc3)C2=O)c1 |
| InChI | InChI=1S/C29H27N3O7/c1-36-21-8-6-7-19(15-21)28(34)31(17-26(37-2)38-3)23-16-25(33)32(29(23)35)20-13-11-18(12-14-20)27-30-22-9-4-5-10-24(22)39-27/h4-15,23,26H,16-17H2,1-3H3 |
| InChIKey | KYMPZDUWQUSXJQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 111.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|