C32H24FN3O5 — CID 23998836
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-2-phenoxyacetamide (PubChem CID 23998836) has the molecular formula C32H24FN3O5 and a molecular weight of 549.56 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-2-phenoxyacetamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 23998836 |
| Molecular Formula | C32H24FN3O5 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-2-phenoxyacetamide |
| SMILES | O=C1CC(N(Cc2ccc(F)cc2)C(=O)COc2ccccc2)C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C32H24FN3O5/c33-23-14-10-21(11-15-23)19-35(30(38)20-40-25-6-2-1-3-7-25)27-18-29(37)36(32(27)39)24-16-12-22(13-17-24)31-34-26-8-4-5-9-28(26)41-31/h1-17,27H,18-20H2 |
| InChIKey | MNGUMZPKLUYFQE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|