C33H31N3O5 — CID 23998823
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide (PubChem CID 23998823) has the molecular formula C33H31N3O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 23998823 |
| Molecular Formula | C33H31N3O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide |
| SMILES | O=C1CC(N(CCC2=CCCCC2)C(=O)COc2ccccc2)C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C33H31N3O5/c37-30-21-28(35(20-19-23-9-3-1-4-10-23)31(38)22-40-26-11-5-2-6-12-26)33(39)36(30)25-17-15-24(16-18-25)32-34-27-13-7-8-14-29(27)41-32/h2,5-9,11-18,28H,1,3-4,10,19-22H2 |
| InChIKey | TXLMVNRFZMKODL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|