C27H19N3O6 — CID 23943140
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide (PubChem CID 23943140) has the molecular formula C27H19N3O6 and a molecular weight of 481.46 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 23943140 |
| Molecular Formula | C27H19N3O6 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide |
| SMILES | O=C1CC(N(Cc2ccco2)C(=O)c2ccco2)C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C27H19N3O6/c31-24-15-21(29(16-19-5-3-13-34-19)27(33)23-8-4-14-35-23)26(32)30(24)18-11-9-17(10-12-18)25-28-20-6-1-2-7-22(20)36-25/h1-14,21H,15-16H2 |
| InChIKey | ZBXSYBJNJABTQM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 110.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|