C30H29N3O4 — CID 23915149
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-2-phenylacetamide (PubChem CID 23915149) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-2-phenylacetamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 23915149 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)-2-phenylacetamide |
| SMILES | CCC(C)(C)N(C(=O)Cc1ccccc1)C1CC(=O)N(c2ccc(-c3nc4ccccc4o3)cc2)C1=O |
| InChI | InChI=1S/C30H29N3O4/c1-4-30(2,3)33(27(35)18-20-10-6-5-7-11-20)24-19-26(34)32(29(24)36)22-16-14-21(15-17-22)28-31-23-12-8-9-13-25(23)37-28/h5-17,24H,4,18-19H2,1-3H3 |
| InChIKey | ZKVMONNELSJJQF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|