C27H22N5O5+ — CID 53291656
1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]pyrrolidine-2,5-dione (PubChem CID 53291656) has the molecular formula C27H22N5O5+ and a molecular weight of 496.50 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53291656 |
| Molecular Formula | C27H22N5O5+ |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]pyrrolidine-2,5-dione |
| SMILES | CN(Cc1c(=O)o[nH][n+]1-c1ccccc1)C1CC(=O)N(c2ccc(-c3nc4ccccc4o3)cc2)C1=O |
| InChI | InChI=1S/C27H21N5O5/c1-30(16-22-27(35)37-29-32(22)19-7-3-2-4-8-19)21-15-24(33)31(26(21)34)18-13-11-17(12-14-18)25-28-20-9-5-6-10-23(20)36-25/h2-14,21H,15-16H2,1H3/p+1 |
| InChIKey | VRQPVTMTDMJQHQ-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|