C21H21N6O4+ — CID 53291714
3-[methyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione (PubChem CID 53291714) has the molecular formula C21H21N6O4+ and a molecular weight of 421.44 g/mol. Its IUPAC name is 3-[methyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[methyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53291714 |
| Molecular Formula | C21H21N6O4+ |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-[methyl-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione |
| SMILES | CN(Cc1c(=O)o[nH][n+]1C)C1CC(=O)N(c2ccc(/N=N/c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C21H20N6O4/c1-25(13-18-21(30)31-24-26(18)2)17-12-19(28)27(20(17)29)16-10-8-15(9-11-16)23-22-14-6-4-3-5-7-14/h3-11,17H,12-13H2,1-2H3/p+1/b23-22+ |
| InChIKey | DSNKSHAXMOXJIK-GHVJWSGMSA-O |
| XLogP | 1.97 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|