C20H22N4O2 — CID 7303465
(3S)-3-(diethylamino)-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione (PubChem CID 7303465) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (3S)-3-(diethylamino)-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(diethylamino)-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7303465 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (3S)-3-(diethylamino)-1-(4-phenyldiazenylphenyl)pyrrolidine-2,5-dione |
| SMILES | CCN(CC)[C@H]1CC(=O)N(c2ccc(/N=N/c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C20H22N4O2/c1-3-23(4-2)18-14-19(25)24(20(18)26)17-12-10-16(11-13-17)22-21-15-8-6-5-7-9-15/h5-13,18H,3-4,14H2,1-2H3/b22-21+/t18-/m0/s1 |
| InChIKey | FKOKZSGGFPYTAY-VEGAHXMMSA-N |
| XLogP | 4.08 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|