C16H18N2O2 — CID 894436
(3R)-3-[bis(prop-2-enyl)amino]-1-phenylpyrrolidine-2,5-dione (PubChem CID 894436) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (3R)-3-[bis(prop-2-enyl)amino]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[bis(prop-2-enyl)amino]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 894436 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3R)-3-[bis(prop-2-enyl)amino]-1-phenylpyrrolidine-2,5-dione |
| SMILES | C=CCN(CC=C)[C@@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H18N2O2/c1-3-10-17(11-4-2)14-12-15(19)18(16(14)20)13-8-6-5-7-9-13/h3-9,14H,1-2,10-12H2/t14-/m1/s1 |
| InChIKey | HDWZMALVXBUZMX-CQSZACIVSA-N |
| XLogP | 1.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|