C21H29N3O3 — CID 7494358
N'-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]undec-10-enehydrazide (PubChem CID 7494358) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N'-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]undec-10-enehydrazide.
| Compound Name | N'-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]undec-10-enehydrazide |
|---|---|
| PubChem CID | 7494358 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N'-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]undec-10-enehydrazide |
| SMILES | C=CCCCCCCCCC(=O)NN[C@@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H29N3O3/c1-2-3-4-5-6-7-8-12-15-19(25)23-22-18-16-20(26)24(21(18)27)17-13-10-9-11-14-17/h2,9-11,13-14,18,22H,1,3-8,12,15-16H2,(H,23,25)/t18-/m1/s1 |
| InChIKey | HAOBORFCOAKYNX-GOSISDBHSA-N |
| XLogP | 3.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|