C19H19N3O4 — CID 1120118
N'-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-(3-methylphenoxy)acetohydrazide (PubChem CID 1120118) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N'-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-(3-methylphenoxy)acetohydrazide.
| Compound Name | N'-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-(3-methylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 1120118 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N'-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-(3-methylphenoxy)acetohydrazide |
| SMILES | Cc1cccc(OCC(=O)NN[C@H]2CC(=O)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C19H19N3O4/c1-13-6-5-9-15(10-13)26-12-17(23)21-20-16-11-18(24)22(19(16)25)14-7-3-2-4-8-14/h2-10,16,20H,11-12H2,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | FFBGFJLDLZRWQV-INIZCTEOSA-N |
| XLogP | 1.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|