C17H18N2O3S — CID 40649593
2-(3-methylphenoxy)-N'-(2-phenylsulfanylacetyl)acetohydrazide (PubChem CID 40649593) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N'-(2-phenylsulfanylacetyl)acetohydrazide.
| Compound Name | 2-(3-methylphenoxy)-N'-(2-phenylsulfanylacetyl)acetohydrazide |
|---|---|
| PubChem CID | 40649593 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(3-methylphenoxy)-N'-(2-phenylsulfanylacetyl)acetohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)CSc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O3S/c1-13-6-5-7-14(10-13)22-11-16(20)18-19-17(21)12-23-15-8-3-2-4-9-15/h2-10H,11-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | VKXJKOSUOXCZFB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|