C23H20N2O4 — CID 7601018
4-benzoyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide (PubChem CID 7601018) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-benzoyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide.
| Compound Name | 4-benzoyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7601018 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-benzoyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2ccc(C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H20N2O4/c1-16-6-5-9-20(14-16)29-15-21(26)24-25-23(28)19-12-10-18(11-13-19)22(27)17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | HAZJEPAIFGHGTD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|