C22H19N3O4 — CID 2119946
3-hydroxy-N'-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-carbohydrazide (PubChem CID 2119946) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-hydroxy-N'-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-carbohydrazide.
| Compound Name | 3-hydroxy-N'-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 2119946 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-hydroxy-N'-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-carbohydrazide |
| SMILES | Cc1ccc(N2C(=O)C[C@H](NNC(=O)c3cc4ccccc4cc3O)C2=O)cc1 |
| InChI | InChI=1S/C22H19N3O4/c1-13-6-8-16(9-7-13)25-20(27)12-18(22(25)29)23-24-21(28)17-10-14-4-2-3-5-15(14)11-19(17)26/h2-11,18,23,26H,12H2,1H3,(H,24,28)/t18-/m0/s1 |
| InChIKey | HLSALYVSBDVKIB-SFHVURJKSA-N |
| XLogP | 2.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|