C24H23N3O3S — CID 4836158
3-(4-methylphenyl)sulfanyl-N'-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)propanehydrazide (PubChem CID 4836158) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfanyl-N'-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)propanehydrazide.
| Compound Name | 3-(4-methylphenyl)sulfanyl-N'-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)propanehydrazide |
|---|---|
| PubChem CID | 4836158 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-(4-methylphenyl)sulfanyl-N'-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)propanehydrazide |
| SMILES | Cc1ccc(SCCC(=O)NNC2CC(=O)N(c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c1-16-6-10-20(11-7-16)31-13-12-22(28)26-25-21-15-23(29)27(24(21)30)19-9-8-17-4-2-3-5-18(17)14-19/h2-11,14,21,25H,12-13,15H2,1H3,(H,26,28) |
| InChIKey | BJESEZHIQVTOOY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|