C19H15FN4O3S2 — CID 125117682
2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetohydrazide (PubChem CID 125117682) has the molecular formula C19H15FN4O3S2 and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetohydrazide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 125117682 |
| Molecular Formula | C19H15FN4O3S2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetohydrazide |
| SMILES | O=C(CSc1nc2ccccc2s1)NN[C@@H]1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H15FN4O3S2/c20-11-5-7-12(8-6-11)24-17(26)9-14(18(24)27)22-23-16(25)10-28-19-21-13-3-1-2-4-15(13)29-19/h1-8,14,22H,9-10H2,(H,23,25)/t14-/m1/s1 |
| InChIKey | MHBWLWLFMBLRDN-CQSZACIVSA-N |
| XLogP | 2.48 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|